Products 2378502-82-8

CAS 2378502-82-8 is the registry number for 4-Chloro-1-methylpiperidine-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-chloro-1-methylpiperidine-4-carboxylic acid;hydrochloride (CAS 2378502-82-8) is a chemical compound with the molecular formula C7H13Cl2NO2 and a molecular weight of 214.09 g/mol. IUPAC name: 4-chloro-1-methylpiperidine-4-carboxylic acid;hydrochloride. InChIKey: RQVIEDUOVQWUAV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13Cl2NO2
Molecular weight214.09 g/mol
IUPAC name4-chloro-1-methylpiperidine-4-carboxylic acid;hydrochloride
InChIKeyRQVIEDUOVQWUAV-UHFFFAOYSA-N
SMILESCN1CCC(CC1)(C(=O)O)Cl.Cl

Computed by PubChem (NCBI)