CAS 107833-98-7 appears in our catalog under these names: Nicorandil Impurity 11, Nicorandil Pyridine N-Oxide, Nicorandil N-Oxide, Nicorandil Pyridine Oxide, Nicorandil N–oxide. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 5mg, 1mg, 10mg, 10 mg, 25 mg.
2-[(1-oxidopyridin-1-ium-3-carbonyl)amino]ethyl nitrate (CAS 107833-98-7) is a chemical compound with the molecular formula C8H9N3O5 and a molecular weight of 227.17 g/mol. IUPAC name: 2-[(1-oxidopyridin-1-ium-3-carbonyl)amino]ethyl nitrate. InChIKey: NALIEKHMDVZBFP-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O5 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 2-[(1-oxidopyridin-1-ium-3-carbonyl)amino]ethyl nitrate |
| InChIKey | NALIEKHMDVZBFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C[N+](=C1)[O-])C(=O)NCCO[N+](=O)[O-] |
Computed by PubChem (NCBI)