CAS 113743-17-2 appears in our catalog under these names: 6-Hydroxy Nicorandil, Nicorandil Impurity 18, Nicorandil Impurity 22, 6-Hydroxy Nicorandil-d4. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[(6-oxo-1H-pyridine-3-carbonyl)amino]ethyl nitrate (CAS 113743-17-2) is a chemical compound with the molecular formula C8H9N3O5 and a molecular weight of 227.17 g/mol. IUPAC name: 2-[(6-oxo-1H-pyridine-3-carbonyl)amino]ethyl nitrate. InChIKey: KPGQDUMCVZGWBO-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O5 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 2-[(6-oxo-1H-pyridine-3-carbonyl)amino]ethyl nitrate |
| InChIKey | KPGQDUMCVZGWBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC=C1C(=O)NCCO[N+](=O)[O-] |
Computed by PubChem (NCBI)