CAS 107865-00-9 appears in our catalog under these names: 4-(3-Aminophenyl)phenol, 96%, 3'-Amino-(1,1'-biphenyl)-4-ol, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4-(3-aminophenyl)phenol (CAS 107865-00-9) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: 4-(3-aminophenyl)phenol. InChIKey: WPUGPMFSEHZORG-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 4-(3-aminophenyl)phenol |
| InChIKey | WPUGPMFSEHZORG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)