Products 1079656-72-6
CAS 1079656-72-6 is the registry number for (1R)-1-[3-(difluoromethoxy)phenyl]ethan-1-amine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-[3-(difluoromethoxy)phenyl]ethanamine (CAS 1079656-72-6) is a chemical compound with the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. IUPAC name: (1R)-1-[3-(difluoromethoxy)phenyl]ethanamine. InChIKey: KXLKJIXCWFZYIE-ZCFIWIBFSA-N.
| Molecular formula | C9H11F2NO |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | (1R)-1-[3-(difluoromethoxy)phenyl]ethanamine |
| InChIKey | KXLKJIXCWFZYIE-ZCFIWIBFSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)OC(F)F)N |
Computed by PubChem (NCBI)