CAS 1369403-37-1 is the registry number for 2-Amino-3-(2,6-difluorophenyl)propan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
2-amino-3-(2,6-difluorophenyl)propan-1-ol (CAS 1369403-37-1) is a chemical compound with the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. IUPAC name: 2-amino-3-(2,6-difluorophenyl)propan-1-ol. InChIKey: PUTYJIUDWFEQCD-UHFFFAOYSA-N.
| Molecular formula | C9H11F2NO |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 2-amino-3-(2,6-difluorophenyl)propan-1-ol |
| InChIKey | PUTYJIUDWFEQCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CC(CO)N)F |
Computed by PubChem (NCBI)