CAS 107975-81-5 appears in our catalog under these names: sodium 4-hydroxy-2,2-dimethylbutanoate, 95%, Sodium 4-hydroxy-2,2-dimethylbutanoate, 97%, Sodium 4-hydroxy-2,2-dimethylbutanoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg.
Sodium 4-hydroxy-2,2-dimethylbutanoate (CAS 107975-81-5) is a chemical compound with the molecular formula C6H11NaO3 and a molecular weight of 154.14 g/mol. IUPAC name: sodium 4-hydroxy-2,2-dimethylbutanoate. InChIKey: DMLOOAKBXWQBNJ-UHFFFAOYSA-M.
| Molecular formula | C6H11NaO3 |
|---|---|
| Molecular weight | 154.14 g/mol |
| IUPAC name | sodium 4-hydroxy-2,2-dimethylbutanoate |
| InChIKey | DMLOOAKBXWQBNJ-UHFFFAOYSA-M |
| SMILES | CC(C)(CCO)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)