CAS 2108576-19-6 is the registry number for Sodium 4-hydroxy-3,3-dimethylbutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Sodium 4-hydroxy-3,3-dimethylbutanoate (CAS 2108576-19-6) is a chemical compound with the molecular formula C6H11NaO3 and a molecular weight of 154.14 g/mol. IUPAC name: sodium 4-hydroxy-3,3-dimethylbutanoate. InChIKey: FZGMFSZGFPECGG-UHFFFAOYSA-M.
| Molecular formula | C6H11NaO3 |
|---|---|
| Molecular weight | 154.14 g/mol |
| IUPAC name | sodium 4-hydroxy-3,3-dimethylbutanoate |
| InChIKey | FZGMFSZGFPECGG-UHFFFAOYSA-M |
| SMILES | CC(C)(CC(=O)[O-])CO.[Na+] |
Computed by PubChem (NCBI)