Products 107975-86-0
CAS 107975-86-0 appears in our catalog under these names: Glyme (1,2-dimethoxyethane-d10), >95% (GC), D10-1,2-Dimethoxyethane. Offered by: TRC, HPC Standards. Available pack sizes: 100mg, 1g, 500mg, 1x10mg.
1,1,2,2-tetradeuterio-1,2-bis(trideuteriomethoxy)ethane (CAS 107975-86-0) is a chemical compound with the molecular formula C4H10O2 and a molecular weight of 100.18 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-1,2-bis(trideuteriomethoxy)ethane. InChIKey: XTHFKEDIFFGKHM-MWUKXHIBSA-N.
| Molecular formula | C4H10O2 |
|---|---|
| Molecular weight | 100.18 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-1,2-bis(trideuteriomethoxy)ethane |
| InChIKey | XTHFKEDIFFGKHM-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])OC([2H])([2H])C([2H])([2H])OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)