Products 143585-58-4
CAS 143585-58-4 is the registry number for 1,2-Dimethoxyethane-d4. Offered by: TRC. Available pack sizes: 25mg.
1,1,2,2-tetradeuterio-1,2-dimethoxyethane (CAS 143585-58-4) is a chemical compound with the molecular formula C4H10O2 and a molecular weight of 94.15 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-1,2-dimethoxyethane. InChIKey: XTHFKEDIFFGKHM-KHORGVISSA-N.
| Molecular formula | C4H10O2 |
|---|---|
| Molecular weight | 94.15 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-1,2-dimethoxyethane |
| InChIKey | XTHFKEDIFFGKHM-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OC)OC |
Computed by PubChem (NCBI)