CAS 1080-02-0 is the registry number for 4-Nitrobenzeneazomalononitrile. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
2-[(4-nitrophenyl)diazenyl]propanedinitrile (CAS 1080-02-0) is a chemical compound with the molecular formula C9H5N5O2 and a molecular weight of 215.17 g/mol. IUPAC name: 2-[(4-nitrophenyl)diazenyl]propanedinitrile. InChIKey: JGNLOOXOIBSOLU-UHFFFAOYSA-N.
| Molecular formula | C9H5N5O2 |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 2-[(4-nitrophenyl)diazenyl]propanedinitrile |
| InChIKey | JGNLOOXOIBSOLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC(C#N)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)