CAS 19005-66-4 appears in our catalog under these names: 3-Nitro-4-(1H-1,2,4-triazol-1-yl)benzonitrile, 95%, 3-Nitro-4-(1H-1,2,4-triazol-1-yl)benzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-nitro-4-(1,2,4-triazol-1-yl)benzonitrile (CAS 19005-66-4) is a chemical compound with the molecular formula C9H5N5O2 and a molecular weight of 215.17 g/mol. IUPAC name: 3-nitro-4-(1,2,4-triazol-1-yl)benzonitrile. InChIKey: ZPWZGQAOSBAPRD-UHFFFAOYSA-N.
| Molecular formula | C9H5N5O2 |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 3-nitro-4-(1,2,4-triazol-1-yl)benzonitrile |
| InChIKey | ZPWZGQAOSBAPRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)[N+](=O)[O-])N2C=NC=N2 |
Computed by PubChem (NCBI)