CAS 108030-86-0 is the registry number for 4-(Pyrazin-2-yl)phenol, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-pyrazin-2-ylphenol (CAS 108030-86-0) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 4-pyrazin-2-ylphenol. InChIKey: PNSWNYYMDRNEFB-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 4-pyrazin-2-ylphenol |
| InChIKey | PNSWNYYMDRNEFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=CN=C2)O |
Computed by PubChem (NCBI)