CAS 1080533-14-7 is the registry number for 3,4-Diacetate Methyl Ester 1,2-Anhydro-alpha-D-Glucopyranuronic Acid. Offered by: TRC. Available pack sizes: 25mg.
[(1S,3R,4R,5S,6R)-5-acetyloxy-3-methyl-2,7-dioxabicyclo[4.1.0]heptan-4-yl] acetate;carbon dioxide (CAS 1080533-14-7) is a chemical compound with the molecular formula C11H14O8 and a molecular weight of 274.22 g/mol. IUPAC name: [(1S,3R,4R,5S,6R)-5-acetyloxy-3-methyl-2,7-dioxabicyclo[4.1.0]heptan-4-yl] acetate;carbon dioxide. InChIKey: FLKBYVFPGQEASU-TVOACLMSSA-N.
| Molecular formula | C11H14O8 |
|---|---|
| Molecular weight | 274.22 g/mol |
| IUPAC name | [(1S,3R,4R,5S,6R)-5-acetyloxy-3-methyl-2,7-dioxabicyclo[4.1.0]heptan-4-yl] acetate;carbon dioxide |
| InChIKey | FLKBYVFPGQEASU-TVOACLMSSA-N |
| SMILES | C[C@@H]1[C@H]([C@@H]([C@@H]2[C@H](O1)O2)OC(=O)C)OC(=O)C.C(=O)=O |
Computed by PubChem (NCBI)