Products 41162-32-7
CAS 41162-32-7 is the registry number for (2R,3R,4R)-2-(Acetoxymethyl)-5-oxotetrahydrofuran-3,4-diyl diacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R)-3,4-diacetyloxy-5-oxooxolan-2-yl]methyl acetate (CAS 41162-32-7) is a chemical compound with the molecular formula C11H14O8 and a molecular weight of 274.22 g/mol. IUPAC name: [(2R,3R,4R)-3,4-diacetyloxy-5-oxooxolan-2-yl]methyl acetate. InChIKey: JIILXWRHIYAEQM-OPRDCNLKSA-N.
| Molecular formula | C11H14O8 |
|---|---|
| Molecular weight | 274.22 g/mol |
| IUPAC name | [(2R,3R,4R)-3,4-diacetyloxy-5-oxooxolan-2-yl]methyl acetate |
| InChIKey | JIILXWRHIYAEQM-OPRDCNLKSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H](C(=O)O1)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)