Products 1081146-38-4
CAS 1081146-38-4 is the registry number for 3-((1-Methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)amino)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothiolan-3-yl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 1081146-38-4) is a chemical compound with the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. IUPAC name: N-(1,1-dioxothiolan-3-yl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: NYELNXTUKUWNEI-UHFFFAOYSA-N.
| Molecular formula | C10H13N5O2S |
|---|---|
| Molecular weight | 267.31 g/mol |
| IUPAC name | N-(1,1-dioxothiolan-3-yl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | NYELNXTUKUWNEI-UHFFFAOYSA-N |
| SMILES | CN1C2=NC=NC(=C2C=N1)NC3CCS(=O)(=O)C3 |
Computed by PubChem (NCBI)