Products 1474064-97-5
CAS 1474064-97-5 is the registry number for 3-(4-Amino-1H-pyrazolo[3,4-d]pyrimidin-1-yl)-3-methyltetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS 1474064-97-5) is a chemical compound with the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. IUPAC name: 1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: MYHTWMKNDSZAAU-UHFFFAOYSA-N.
| Molecular formula | C10H13N5O2S |
|---|---|
| Molecular weight | 267.31 g/mol |
| IUPAC name | 1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | MYHTWMKNDSZAAU-UHFFFAOYSA-N |
| SMILES | CC1(CCS(=O)(=O)C1)N2C3=NC=NC(=C3C=N2)N |
Computed by PubChem (NCBI)