Products 122510-61-6

CAS 122510-61-6 is the registry number for AF615, 99.55%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 10mM/1mL, 10 mg.

Structural formula: {0} (CAS {1})

N'-(morpholine-4-carbothioyl)pyrazine-2-carbohydrazide (CAS 122510-61-6) is a chemical compound with the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. IUPAC name: N'-(morpholine-4-carbothioyl)pyrazine-2-carbohydrazide. InChIKey: MVIKQAFXLHULLI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13N5O2S
Molecular weight267.31 g/mol
IUPAC nameN'-(morpholine-4-carbothioyl)pyrazine-2-carbohydrazide
InChIKeyMVIKQAFXLHULLI-UHFFFAOYSA-N
SMILESC1COCCN1C(=S)NNC(=O)C2=NC=CN=C2

Computed by PubChem (NCBI)