Products 1081787-87-2

CAS 1081787-87-2 is the registry number for 3-Propylisonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-propylpyridine-4-carboxylic acid (CAS 1081787-87-2) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 3-propylpyridine-4-carboxylic acid. InChIKey: MXRBEFRYLZYIEO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO2
Molecular weight165.19 g/mol
IUPAC name3-propylpyridine-4-carboxylic acid
InChIKeyMXRBEFRYLZYIEO-UHFFFAOYSA-N
SMILESCCCC1=C(C=CN=C1)C(=O)O

Computed by PubChem (NCBI)