CAS 1081809-48-4 is the registry number for (2E)-N-(3,4-Dichlorophenyl)-2-(hydroxyimino)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(2E)-N-(3,4-dichlorophenyl)-2-hydroxyiminoacetamide (CAS 1081809-48-4) is a chemical compound with the molecular formula C8H6Cl2N2O2 and a molecular weight of 233.05 g/mol. IUPAC name: (2E)-N-(3,4-dichlorophenyl)-2-hydroxyiminoacetamide. InChIKey: DHNYOOWCULCVEH-NYYWCZLTSA-N.
| Molecular formula | C8H6Cl2N2O2 |
|---|---|
| Molecular weight | 233.05 g/mol |
| IUPAC name | (2E)-N-(3,4-dichlorophenyl)-2-hydroxyiminoacetamide |
| InChIKey | DHNYOOWCULCVEH-NYYWCZLTSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)/C=N/O)Cl)Cl |
Computed by PubChem (NCBI)