CAS 1820717-31-4 appears in our catalog under these names: 7-Chloro-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride, 96%, 7-Chloro-1H-benzo(d)imidazole-5-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
7-chloro-3H-benzimidazole-5-carboxylic acid;hydrochloride (CAS 1820717-31-4) is a chemical compound with the molecular formula C8H6Cl2N2O2 and a molecular weight of 233.05 g/mol. IUPAC name: 7-chloro-3H-benzimidazole-5-carboxylic acid;hydrochloride. InChIKey: AZNXELBKUYSULK-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O2 |
|---|---|
| Molecular weight | 233.05 g/mol |
| IUPAC name | 7-chloro-3H-benzimidazole-5-carboxylic acid;hydrochloride |
| InChIKey | AZNXELBKUYSULK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC=N2)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)