Products 214472-41-0

CAS 214472-41-0 is the registry number for Gefitinib Impurity 73. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-amino-4-methoxy-5-(3-morpholin-4-ylpropoxy)benzoate (CAS 214472-41-0) is a chemical compound with the molecular formula C16H24N2O5 and a molecular weight of 324.37 g/mol. IUPAC name: methyl 2-amino-4-methoxy-5-(3-morpholin-4-ylpropoxy)benzoate. InChIKey: DFJJAQKKQNIWOC-UHFFFAOYSA-N.

Identity
Molecular formulaC16H24N2O5
Molecular weight324.37 g/mol
IUPAC namemethyl 2-amino-4-methoxy-5-(3-morpholin-4-ylpropoxy)benzoate
InChIKeyDFJJAQKKQNIWOC-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)N)C(=O)OC)OCCCN2CCOCC2

Computed by PubChem (NCBI)