CAS 1082-19-5 appears in our catalog under these names: 1,10–Phenanthroline–2–carbonitrile, 1,10-Phenanthroline-2-carbonitrile 98%, 1,10-Phenanthroline-2-carbonitrile, 97%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
1,10-phenanthroline-2-carbonitrile (CAS 1082-19-5) is a chemical compound with the molecular formula C13H7N3 and a molecular weight of 205.21 g/mol. IUPAC name: 1,10-phenanthroline-2-carbonitrile. InChIKey: LSMQCFPLQFCYAW-UHFFFAOYSA-N.
| Molecular formula | C13H7N3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 1,10-phenanthroline-2-carbonitrile |
| InChIKey | LSMQCFPLQFCYAW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=C2)C=CC(=N3)C#N)N=C1 |
Computed by PubChem (NCBI)