CAS 6479-93-2 is the registry number for Phenazine-2-carbonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Phenazine-2-carbonitrile (CAS 6479-93-2) is a chemical compound with the molecular formula C13H7N3 and a molecular weight of 205.21 g/mol. IUPAC name: phenazine-2-carbonitrile. InChIKey: IWDIQIINIKFOEB-UHFFFAOYSA-N.
| Molecular formula | C13H7N3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | phenazine-2-carbonitrile |
| InChIKey | IWDIQIINIKFOEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3C=CC(=CC3=N2)C#N |
Computed by PubChem (NCBI)