CAS 1082134-03-9 is the registry number for 5-(4-Fluorophenyl)-2,6-dimethylthieno[2,3-d]pyrimidin-4(3H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-fluorophenyl)-2,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 1082134-03-9) is a chemical compound with the molecular formula C14H11FN2OS and a molecular weight of 274.32 g/mol. IUPAC name: 5-(4-fluorophenyl)-2,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: IXWVWSYQNFBAQD-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2OS |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-2,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | IXWVWSYQNFBAQD-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(S1)N=C(NC2=O)C)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)