CAS 637003-10-2 is the registry number for 2-(3-Fluoro-4-(methylamino)phenyl)benzo(d)thiazol-6-ol, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
2-[3-fluoro-4-(methylamino)phenyl]-1,3-benzothiazol-6-ol (CAS 637003-10-2) is a chemical compound with the molecular formula C14H11FN2OS and a molecular weight of 274.32 g/mol. IUPAC name: 2-[3-fluoro-4-(methylamino)phenyl]-1,3-benzothiazol-6-ol. InChIKey: VVECGOCJFKTUAX-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2OS |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | 2-[3-fluoro-4-(methylamino)phenyl]-1,3-benzothiazol-6-ol |
| InChIKey | VVECGOCJFKTUAX-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)C2=NC3=C(S2)C=C(C=C3)O)F |
Computed by PubChem (NCBI)