CAS 108238-10-4 is the registry number for 2-(Bromomethyl)-1-methylnaphthalene, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-(bromomethyl)-1-methylnaphthalene (CAS 108238-10-4) is a chemical compound with the molecular formula C12H11Br and a molecular weight of 235.12 g/mol. IUPAC name: 2-(bromomethyl)-1-methylnaphthalene. InChIKey: GANBSOXQWLYXOE-UHFFFAOYSA-N.
| Molecular formula | C12H11Br |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | 2-(bromomethyl)-1-methylnaphthalene |
| InChIKey | GANBSOXQWLYXOE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=CC=CC=C12)CBr |
Computed by PubChem (NCBI)