Products 15095-54-2
CAS 15095-54-2 appears in our catalog under these names: 4-bromo-1,5-dimethyl-naphthalene, 97%, 97%, 4-Bromo-1,5-dimethyl-naphthalene, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
4-bromo-1,5-dimethylnaphthalene (CAS 15095-54-2) is a chemical compound with the molecular formula C12H11Br and a molecular weight of 235.12 g/mol. IUPAC name: 4-bromo-1,5-dimethylnaphthalene. InChIKey: XTBNCFCOYAFCIB-UHFFFAOYSA-N.
| Molecular formula | C12H11Br |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | 4-bromo-1,5-dimethylnaphthalene |
| InChIKey | XTBNCFCOYAFCIB-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC=C2Br)C |
Computed by PubChem (NCBI)