Products 1082398-97-7

CAS 1082398-97-7 is the registry number for 3-(5-Methyl-1,3-oxazol-2-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(5-methyl-1,3-oxazol-2-yl)propanoic acid (CAS 1082398-97-7) is a chemical compound with the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. IUPAC name: 3-(5-methyl-1,3-oxazol-2-yl)propanoic acid. InChIKey: YURGBFKFPKNVTF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO3
Molecular weight155.15 g/mol
IUPAC name3-(5-methyl-1,3-oxazol-2-yl)propanoic acid
InChIKeyYURGBFKFPKNVTF-UHFFFAOYSA-N
SMILESCC1=CN=C(O1)CCC(=O)O

Computed by PubChem (NCBI)