CAS 127682-08-0 appears in our catalog under these names: (S)-2-Amino-3-(furan-2-yl)propanoic acid hydrochloride, 95%, (S)-2-Amino-3-(furan-2-yl)propanoic acid hydrochloride, 98%, H-L-Ala(2-Furyl)-OH, (S)-2-Amino-3-(furan-2-yl)propanoic acid hydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
(2S)-2-amino-3-(furan-2-yl)propanoic acid (CAS 127682-08-0) is a chemical compound with the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. IUPAC name: (2S)-2-amino-3-(furan-2-yl)propanoic acid. InChIKey: RXZQHZDTHUUJQJ-LURJTMIESA-N.
| Molecular formula | C7H9NO3 |
|---|---|
| Molecular weight | 155.15 g/mol |
| IUPAC name | (2S)-2-amino-3-(furan-2-yl)propanoic acid |
| InChIKey | RXZQHZDTHUUJQJ-LURJTMIESA-N |
| SMILES | C1=COC(=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)