Products 1185319-75-8
CAS 1185319-75-8 is the registry number for 2–Chloro–3–cyano–6–(iso–propyl–d7)–pyridine. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
2-chloro-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyridine-3-carbonitrile (CAS 1185319-75-8) is a chemical compound with the molecular formula C9H9ClN2 and a molecular weight of 187.68 g/mol. IUPAC name: 2-chloro-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyridine-3-carbonitrile. InChIKey: KZXQCYPAMGNZPE-NWOXSKRJSA-N.
| Molecular formula | C9H9ClN2 |
|---|---|
| Molecular weight | 187.68 g/mol |
| IUPAC name | 2-chloro-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyridine-3-carbonitrile |
| InChIKey | KZXQCYPAMGNZPE-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=NC(=C(C=C1)C#N)Cl)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)