Products 1082581-90-5
CAS 1082581-90-5 is the registry number for Ethyl-d5 Caproate. Offered by: TRC. Available pack sizes: 100mg.
1,1,2,2,2-pentadeuterioethyl hexanoate (CAS 1082581-90-5) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 149.24 g/mol. IUPAC name: 1,1,2,2,2-pentadeuterioethyl hexanoate. InChIKey: SHZIWNPUGXLXDT-PVGOWFQYSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 149.24 g/mol |
| IUPAC name | 1,1,2,2,2-pentadeuterioethyl hexanoate |
| InChIKey | SHZIWNPUGXLXDT-PVGOWFQYSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)CCCCC |
Computed by PubChem (NCBI)