Products 2159-19-5
CAS 2159-19-5 appears in our catalog under these names: Ethyl Caproate-d11, Ethyl Hexanoate-d11, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 1mg, 25mg, 50mg, 0,25g, 0,1g.
Ethyl 2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate (CAS 2159-19-5) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 155.28 g/mol. IUPAC name: ethyl 2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate. InChIKey: SHZIWNPUGXLXDT-LELBNVJRSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 155.28 g/mol |
| IUPAC name | ethyl 2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate |
| InChIKey | SHZIWNPUGXLXDT-LELBNVJRSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OCC |
Computed by PubChem (NCBI)