CAS 1082913-84-5 is the registry number for 4-(Chloromethyl)-2-(phenoxymethyl)-1,3-thiazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(chloromethyl)-2-(phenoxymethyl)-1,3-thiazole (CAS 1082913-84-5) is a chemical compound with the molecular formula C11H10ClNOS and a molecular weight of 239.72 g/mol. IUPAC name: 4-(chloromethyl)-2-(phenoxymethyl)-1,3-thiazole. InChIKey: XAXNMFRKMJBTSO-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNOS |
|---|---|
| Molecular weight | 239.72 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(phenoxymethyl)-1,3-thiazole |
| InChIKey | XAXNMFRKMJBTSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=NC(=CS2)CCl |
Computed by PubChem (NCBI)