Products 2108997-71-1
CAS 2108997-71-1 is the registry number for (4-Aminophenyl)(2-thienyl)methanone hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 25g, 1g.
(4-aminophenyl)-thiophen-2-ylmethanone;hydrochloride (CAS 2108997-71-1) is a chemical compound with the molecular formula C11H10ClNOS and a molecular weight of 239.72 g/mol. IUPAC name: (4-aminophenyl)-thiophen-2-ylmethanone;hydrochloride. InChIKey: RLQAKHPSODDTIC-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNOS |
|---|---|
| Molecular weight | 239.72 g/mol |
| IUPAC name | (4-aminophenyl)-thiophen-2-ylmethanone;hydrochloride |
| InChIKey | RLQAKHPSODDTIC-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)