CAS 108307-43-3 is the registry number for Dineophyldiphenyltin. Offered by: TRC. Available pack sizes: 1g.
Bis(2-methyl-2-phenylpropyl)-diphenylstannane (CAS 108307-43-3) is a chemical compound with the molecular formula C32H36Sn and a molecular weight of 539.3 g/mol. IUPAC name: bis(2-methyl-2-phenylpropyl)-diphenylstannane. InChIKey: WAHHDWISKYPSNE-UHFFFAOYSA-N.
| Molecular formula | C32H36Sn |
|---|---|
| Molecular weight | 539.3 g/mol |
| IUPAC name | bis(2-methyl-2-phenylpropyl)-diphenylstannane |
| InChIKey | WAHHDWISKYPSNE-UHFFFAOYSA-N |
| SMILES | CC(C)(C[Sn](CC(C)(C)C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)