CAS 134917-88-7 is the registry number for Tetrakis-(4-methyl-benzyl)-stannane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 100mg, 1g.
Tetrakis[(4-methylphenyl)methyl]stannane (CAS 134917-88-7) is a chemical compound with the molecular formula C32H36Sn and a molecular weight of 539.3 g/mol. IUPAC name: tetrakis[(4-methylphenyl)methyl]stannane. InChIKey: OQHYJULTFDKYRA-UHFFFAOYSA-N.
| Molecular formula | C32H36Sn |
|---|---|
| Molecular weight | 539.3 g/mol |
| IUPAC name | tetrakis[(4-methylphenyl)methyl]stannane |
| InChIKey | OQHYJULTFDKYRA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C[Sn](CC2=CC=C(C=C2)C)(CC3=CC=C(C=C3)C)CC4=CC=C(C=C4)C |
Computed by PubChem (NCBI)