CAS 108397-75-7 is the registry number for 2,4,6-Trimethylpyrimidine-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2,4,6-trimethylpyrimidine-5-carboxylic acid (CAS 108397-75-7) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2,4,6-trimethylpyrimidine-5-carboxylic acid. InChIKey: DRDANIHGQXLGSQ-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2,4,6-trimethylpyrimidine-5-carboxylic acid |
| InChIKey | DRDANIHGQXLGSQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)C)C)C(=O)O |
Computed by PubChem (NCBI)