CAS 108413-50-9 is the registry number for 5-(3-(Trifluoromethyl)phenyl)-1,3,4-oxadiazole-2-thiol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[3-(trifluoromethyl)phenyl]-3H-1,3,4-oxadiazole-2-thione (CAS 108413-50-9) is a chemical compound with the molecular formula C9H5F3N2OS and a molecular weight of 246.21 g/mol. IUPAC name: 5-[3-(trifluoromethyl)phenyl]-3H-1,3,4-oxadiazole-2-thione. InChIKey: NOUYMYSPIXNRAD-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2OS |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 5-[3-(trifluoromethyl)phenyl]-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | NOUYMYSPIXNRAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)