CAS 926197-60-6 is the registry number for 2-Thioxo-7-(trifluoromethyl)-2,3-dihydroquinazolin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-sulfanylidene-7-(trifluoromethyl)-1H-quinazolin-4-one (CAS 926197-60-6) is a chemical compound with the molecular formula C9H5F3N2OS and a molecular weight of 246.21 g/mol. IUPAC name: 2-sulfanylidene-7-(trifluoromethyl)-1H-quinazolin-4-one. InChIKey: RNPRXOQIOBQHPL-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2OS |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 2-sulfanylidene-7-(trifluoromethyl)-1H-quinazolin-4-one |
| InChIKey | RNPRXOQIOBQHPL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)NC(=S)NC2=O |
Computed by PubChem (NCBI)