Products 1084341-45-6
CAS 1084341-45-6 is the registry number for (3R,5R)-1,3,5-trimethylpiperazine dihydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3R,5R)-1,3,5-trimethylpiperazine;dihydrochloride (CAS 1084341-45-6) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: (3R,5R)-1,3,5-trimethylpiperazine;dihydrochloride. InChIKey: KGVXZTATLSJCPV-GPJOBVNKSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | (3R,5R)-1,3,5-trimethylpiperazine;dihydrochloride |
| InChIKey | KGVXZTATLSJCPV-GPJOBVNKSA-N |
| SMILES | C[C@@H]1CN(C[C@H](N1)C)C.Cl.Cl |
Computed by PubChem (NCBI)