Products 2306249-13-6
CAS 2306249-13-6 is the registry number for (3S,5S)-1,3,5-trimethylpiperazine dihydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(3S,5S)-1,3,5-trimethylpiperazine;dihydrochloride (CAS 2306249-13-6) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: (3S,5S)-1,3,5-trimethylpiperazine;dihydrochloride. InChIKey: KGVXZTATLSJCPV-JFYKYWLVSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | (3S,5S)-1,3,5-trimethylpiperazine;dihydrochloride |
| InChIKey | KGVXZTATLSJCPV-JFYKYWLVSA-N |
| SMILES | C[C@H]1CN(C[C@@H](N1)C)C.Cl.Cl |
Computed by PubChem (NCBI)