Products 108446-75-9

CAS 108446-75-9 is the registry number for 3-[3-(4-Methoxy-phenyl)-1-phenyl-1h-pyrazol-4-yl]-acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(E)-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoic acid (CAS 108446-75-9) is a chemical compound with the molecular formula C19H16N2O3 and a molecular weight of 320.3 g/mol. IUPAC name: (E)-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoic acid. InChIKey: QQLAJYFBOAHMSU-FMIVXFBMSA-N.

Identity
Molecular formulaC19H16N2O3
Molecular weight320.3 g/mol
IUPAC name(E)-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoic acid
InChIKeyQQLAJYFBOAHMSU-FMIVXFBMSA-N
SMILESCOC1=CC=C(C=C1)C2=NN(C=C2/C=C/C(=O)O)C3=CC=CC=C3

Computed by PubChem (NCBI)