Products 2796282-58-9
CAS 2796282-58-9 appears in our catalog under these names: HDAC6-IN-9, 4-[(Hydroxyamino)carbonyl]-N-2-naphthalenylbenzeneacetamide, 98%, 98%. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 25 mg, 5 mg, 50 mg.
N-hydroxy-4-[2-(naphthalen-2-ylamino)-2-oxoethyl]benzamide (CAS 2796282-58-9) is a chemical compound with the molecular formula C19H16N2O3 and a molecular weight of 320.3 g/mol. IUPAC name: N-hydroxy-4-[2-(naphthalen-2-ylamino)-2-oxoethyl]benzamide. InChIKey: FZKJTCLVJNEICF-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O3 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | N-hydroxy-4-[2-(naphthalen-2-ylamino)-2-oxoethyl]benzamide |
| InChIKey | FZKJTCLVJNEICF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NC(=O)CC3=CC=C(C=C3)C(=O)NO |
Computed by PubChem (NCBI)