CAS 108457-42-7 is the registry number for Glutathione Impurity 4. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2R)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (CAS 108457-42-7) is a chemical compound with the molecular formula C10H17N3O6S and a molecular weight of 307.33 g/mol. IUPAC name: (2R)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid. InChIKey: RWSXRVCMGQZWBV-RITPCOANSA-N.
| Molecular formula | C10H17N3O6S |
|---|---|
| Molecular weight | 307.33 g/mol |
| IUPAC name | (2R)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| InChIKey | RWSXRVCMGQZWBV-RITPCOANSA-N |
| SMILES | C(CC(=O)N[C@@H](CS)C(=O)NCC(=O)O)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)