CAS 128960-77-0 is the registry number for Glutathione Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-5-[[(2S)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (CAS 128960-77-0) is a chemical compound with the molecular formula C10H17N3O6S and a molecular weight of 307.33 g/mol. IUPAC name: (2S)-2-amino-5-[[(2S)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid. InChIKey: RWSXRVCMGQZWBV-NTSWFWBYSA-N.
| Molecular formula | C10H17N3O6S |
|---|---|
| Molecular weight | 307.33 g/mol |
| IUPAC name | (2S)-2-amino-5-[[(2S)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| InChIKey | RWSXRVCMGQZWBV-NTSWFWBYSA-N |
| SMILES | C(CC(=O)N[C@H](CS)C(=O)NCC(=O)O)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)