CAS 1084953-24-1 is the registry number for {3-((4-Bromophenoxy)methyl)oxetan-3-yl}methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[3-[(4-bromophenoxy)methyl]oxetan-3-yl]methanamine (CAS 1084953-24-1) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: [3-[(4-bromophenoxy)methyl]oxetan-3-yl]methanamine. InChIKey: KDYUHYKXXIHXQG-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | [3-[(4-bromophenoxy)methyl]oxetan-3-yl]methanamine |
| InChIKey | KDYUHYKXXIHXQG-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(CN)COC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)