CAS 1085333-94-3 appears in our catalog under these names: (±)-Metanephrine-alpha,beta,beta-d3 HCl, 98 atom % D, min 98% Chemical Purity, DL-Metanephrine-d3 Hydrochloride/ 98%, DL–Metanephrine hydrochloride (a,b,b–d3, 98%), DL-Metanephrine (hydrochloride) (a,b,b-d3, 98%), 99.34%. Offered by: CDN, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 5mg, 10mg, 1 mg, 5 mg.
2-methoxy-4-[1,2,2-trideuterio-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride (CAS 1085333-94-3) is a chemical compound with the molecular formula C10H16ClNO3 and a molecular weight of 236.71 g/mol. IUPAC name: 2-methoxy-4-[1,2,2-trideuterio-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride. InChIKey: HRIQFVCFOPJYEQ-PWTNGEROSA-N.
| Molecular formula | C10H16ClNO3 |
|---|---|
| Molecular weight | 236.71 g/mol |
| IUPAC name | 2-methoxy-4-[1,2,2-trideuterio-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride |
| InChIKey | HRIQFVCFOPJYEQ-PWTNGEROSA-N |
| SMILES | [2H]C([2H])(C([2H])(C1=CC(=C(C=C1)O)OC)O)NC.Cl |
Computed by PubChem (NCBI)