Products 1086136-22-2
CAS 1086136-22-2 appears in our catalog under these names: 5-Oxo-L-proline-d5, >95% (HPLC), L-2-Pyrrolidinone-3,3,4,4,5-d5-5-carboxylic Acid, 98 atom % D, min 98% Chemical Purity, L-Pyroglutamic acid-d5, 98.6%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g, 5 mg, 1 mg.
(2S)-1,2,3,3,4-pentadeuterio-5-oxopyrrolidine-2-carboxylic acid (CAS 1086136-22-2) is a chemical compound with the molecular formula C5H7NO3 and a molecular weight of 134.14 g/mol. IUPAC name: (2S)-1,2,3,3,4-pentadeuterio-5-oxopyrrolidine-2-carboxylic acid. InChIKey: ODHCTXKNWHHXJC-MIFBWXGCSA-N.
| Molecular formula | C5H7NO3 |
|---|---|
| Molecular weight | 134.14 g/mol |
| IUPAC name | (2S)-1,2,3,3,4-pentadeuterio-5-oxopyrrolidine-2-carboxylic acid |
| InChIKey | ODHCTXKNWHHXJC-MIFBWXGCSA-N |
| SMILES | [2H]C1C(=O)N([C@](C1([2H])[2H])([2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)