Products 55443-56-6
CAS 55443-56-6 appears in our catalog under these names: L-Pyroglutamic Acid-13C5, >95% (HPLC), L-Pyroglutamic acid-13C5, L-Pyroglutamic acid-13C5, 0.9966%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
(2S)-5-oxo(2,3,4,5-13C4)azolidine-2-carboxylic acid (CAS 55443-56-6) is a chemical compound with the molecular formula C5H7NO3 and a molecular weight of 134.078 g/mol. IUPAC name: (2S)-5-oxo(2,3,4,5-13C4)azolidine-2-carboxylic acid. InChIKey: ODHCTXKNWHHXJC-WIAREEORSA-N.
| Molecular formula | C5H7NO3 |
|---|---|
| Molecular weight | 134.078 g/mol |
| IUPAC name | (2S)-5-oxo(2,3,4,5-13C4)azolidine-2-carboxylic acid |
| InChIKey | ODHCTXKNWHHXJC-WIAREEORSA-N |
| SMILES | [13CH2]1[13CH2][13C](=O)N[13C@@H]1[13C](=O)O |
Computed by PubChem (NCBI)